A5358712
4′-Methylpropiophenone , 96% , 5337-93-9
CAS NO.:5337-93-9
Empirical Formula: C10H12O
Molecular Weight: 148.2
MDL number: MFCD00009312
EINECS: 226-267-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB87.20 | In Stock |
|
| 500G | RMB300.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7.2 °C |
| Boiling point: | 238-239 °C(lit.) |
| Density | 0.993 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 229 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform and hexane. |
| form | Oil |
| color | Colourless |
| Specific Gravity | 0.99 |
| BRN | 2042137 |
| InChI | InChI=1S/C10H12O/c1-3-10(11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
| InChIKey | PATYHUUYADUHQS-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(=O)CC |
| CAS DataBase Reference | 5337-93-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4'-Methylpropiophenone(5337-93-9) |
Description and Uses
4′-Methylpropiophenone is a chemical reagent used in electrocarboxylation reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29143990 |






