BD3125845
2'-Methylpropiophenone , 95% , 2040-14-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB134.40 | In Stock |
|
| 1g | RMB509.60 | In Stock |
|
| 5g | RMB856.00 | In Stock |
|
| 10g | RMB1652.80 | In Stock |
|
| 25g | RMB3930.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -27.6°C |
| Boiling point: | 219.5°C (estimate) |
| Density | 1.0119 |
| refractive index | 1.5413 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | liquid |
| color | Light Yellow |
| InChI | InChI=1S/C10H12O/c1-3-10(11)9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3 |
| InChIKey | VQHKICGSBBPFFJ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1C)(=O)CC |
Description and Uses
2'-Methylpropiophenone can be used for volatile component analysis in infant formula using SPME coupled with GCxGC-TOFMS.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2914390090 |
