A7820512
盐酸托哌酮 , ≥99% , 3644-61-9
Synonym(s):
2-Methyl-1-(4-methylphenyl)-3-(1-piperidyl)propan-1-one hydrochloride;Menopatol
CAS NO.:3644-61-9
Empirical Formula: C16H24ClNO
Molecular Weight: 281.82
MDL number: MFCD00058211
EINECS: 222-876-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB89.60 | In Stock |
|
| 25G | RMB371.20 | In Stock |
|
| 100g | RMB1055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183°C |
| storage temp. | room temp |
| solubility | H2O: >20mg/mL |
| form | solid |
| color | white |
| PH | pH(50g/l, 25℃) : 4.5~5.5 |
| Water Solubility | almost transparency |
| Merck | 14,9522 |
| InChI | InChI=1S/C16H23NO.ClH/c1-13-6-8-15(9-7-13)16(18)14(2)12-17-10-4-3-5-11-17;/h6-9,14H,3-5,10-12H2,1-2H3;1H |
| InChIKey | ZBUVYROEHQQAKL-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(C)C=C1)C(=O)C(C)CN1CCCCC1.Cl |
| CAS DataBase Reference | 3644-61-9(CAS DataBase Reference) |
Description and Uses
Tolperisone hydrochloride can be used as a muscle relaxant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-52/53-36/37/38 |
| Safety Statements | 26-36-45-61-36/37-37/39 |
| WGK Germany | 3 |
| RTECS | UH1575500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Toxicity | LD50 s.c. in mice: 620 mg/kg (Porszasz, 1961) |







