A5364612
Methyl 3-nitrosalicylate , 98% , 22621-41-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB82.40 | In Stock |
|
| 5G | RMB298.40 | In Stock |
|
| 25G | RMB978.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-132 °C |
| Boiling point: | 263.9±20.0 °C(Predicted) |
| Density | 1.432±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 6.85±0.24(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| InChI | InChI=1S/C8H7NO5/c1-14-8(11)5-3-2-4-6(7(5)10)9(12)13/h2-4,10H,1H3 |
| InChIKey | NIBVYEHAFBEVFI-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC([N+]([O-])=O)=C1O |
Description and Uses
3-Nitrosalicylic Acid Methyl Ester is an derivative of 3-Nitrosalicylic acid (N520905), which has been shown to bind to Molybdenum to impart fertility to soil and water and is a key element in the activity of nitrogenase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| HS Code | 29189990 |
