A5374412
Methyl 3,5-dihydroxybenzoate , 98% , 2150-44-9
CAS NO.:2150-44-9
Empirical Formula: C8H8O4
Molecular Weight: 168.15
MDL number: MFCD00002289
EINECS: 218-426-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB40.80 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 50G | RMB148.80 | In Stock |
|
| 100G | RMB223.20 | In Stock |
|
| 250G | RMB447.20 | In Stock |
|
| 500g | RMB753.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-170 °C (lit.) |
| Boiling point: | 257.07°C (rough estimate) |
| Density | 1.3037 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Powder |
| pka | 8.63±0.10(Predicted) |
| color | Slightly yellow to beige |
| Water Solubility | Slightly soluble in water. |
| BRN | 2091651 |
| InChI | InChI=1S/C8H8O4/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4,9-10H,1H3 |
| InChIKey | RNVFYQUEEMZKLR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(O)=CC(O)=C1 |
| CAS DataBase Reference | 2150-44-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3,5-dihydroxy-, methyl ester (2150-44-9) |
Description and Uses
Methyl 3,5-dihydroxybenzoate was used in the synthesis of cored dendrimers. It was also used in the preparation of bis(5-carbomethoxy-1,3-phenylene)-32-crown-10, a semi-rigid 32-membered ring diester crown ether.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




