A5377812
D-(+)-Mannose , 99% , 3458-28-4
Synonym(s):
D -Mannopyranose
CAS NO.:3458-28-4
Empirical Formula: C6H12O6
Molecular Weight: 180.16
MDL number: MFCD00064122
EINECS: 222-392-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB89.60 | In Stock |
|
| 500G | RMB417.60 | In Stock |
|
| 2.5kg | RMB1567.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-140 °C(lit.) |
| alpha | 14 º (589nm, c=10, H2O) |
| Boiling point: | 232.96°C (rough estimate) |
| Density | 1,539 g/cm3 |
| refractive index | 1.5730 (estimate) |
| storage temp. | room temp |
| solubility | H2O: 50 mg/mL |
| form | powder |
| pka | 12.08(at 25℃) |
| color | White |
| biological source | wood |
| optical activity | [α]20/D +13.8±0.5°, 24 hr, c = 10% in H2O |
| Water Solubility | 2480 g/L (17 ºC) |
| Sensitive | Hygroscopic |
| λmax | λ: 260 nm Amax: 0.1 λ: 280 nm Amax: 0.1 |
| Merck | 14,5747 |
| BRN | 1564373 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | microbiology |
| Cosmetics Ingredients Functions | HUMECTANT |
| InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-ATJJXCEKSA-N |
| SMILES | OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O |
| LogP | -2.71 at 25℃ |
| CAS DataBase Reference | 3458-28-4(CAS DataBase Reference) |
| NIST Chemistry Reference | D-Mannose(3458-28-4) |
| EPA Substance Registry System | D-Mannose (3458-28-4) |
Description and Uses
It has been used in a study to assess the synthesis of a family of amphiphilic glycopolymers. It has also been used in a study to investigate the early detection of bronchiolitis obliterans after lung transplantation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29400010 |
| Storage Class | 11 - Combustible Solids |




![ALPHA-D-MAN-[1->2]-ALPHA-D-MAN-1->OME](https://img.chemicalbook.com/CAS/GIF/59571-75-4.gif)

