A5381212
3,4-(Methylenedioxy)phenylboronic acid , 98% , 94839-07-3
Synonym(s):
1,3-Benzodioxole-5-boronic acid
CAS NO.:94839-07-3
Empirical Formula: C7H7BO4
Molecular Weight: 165.94
MDL number: MFCD01009695
EINECS: 672-307-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.80 | In Stock |
|
| 5G | RMB145.60 | In Stock |
|
| 25G | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-229 °C(lit.) |
| Boiling point: | 347.3±52.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 8.48±0.20(Predicted) |
| form | Powder |
| color | White to off-white |
| BRN | 5523347 |
| InChI | InChI=1S/C7H7BO4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3,9-10H,4H2 |
| InChIKey | CMHPUBKZZPSUIQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C2OCOC2=C1)(O)O |
| CAS DataBase Reference | 94839-07-3(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |



![2-(Benzo[d][1,3]dioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane](https://img.chemicalbook.com/CAS/GIF/94838-82-1.gif)

![(6-Formylbenzo[d][1,3]dioxol-5-yl)boronicacid](https://img.chemicalbook.com/CAS/GIF/94838-88-7.gif)
![(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid](https://img.chemicalbook.com/CAS/GIF/190903-71-0.gif)