A5392856
FenpropidinSolutioninMethanol , 100μg/mLinMethanol,uncertainty3% , 67306-00-7
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB79.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | bp0.2 117°; bp0.045 125°; bp0.032 104° |
| Density | 0.9112 (rough estimate) |
| vapor pressure | 1.7 x 10-2 Pa (25 °C) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform, Ethyl Acetate (Slightly) |
| form | Liquid |
| pka | 10.1 |
| Water Solubility | 530 mg l-1 (pH 7 at 25 °C) |
| color | Clear Colourless |
| Merck | 13,4020 |
| BRN | 5336091 |
| Major Application | agriculture environmental |
| InChI | 1S/C19H31N/c1-16(15-20-12-6-5-7-13-20)14-17-8-10-18(11-9-17)19(2,3)4/h8-11,16H,5-7,12-15H2,1-4H3 |
| InChIKey | MGNFYQILYYYUBS-UHFFFAOYSA-N |
| SMILES | CC(CN1CCCCC1)Cc2ccc(cc2)C(C)(C)C |
| CAS DataBase Reference | 67306-00-7 |
| NIST Chemistry Reference | Fenpropidin(67306-00-7) |
| EPA Substance Registry System | Piperidine, 1-[3-[4-(1,1-dimethylethyl)phenyl]-2-methylpropyl]- (67306-00-7) |
Description and Uses
fenpropidine, a piperidine derivative, and spiroxamine, a dioxolanemethyleneamine derivative introduced in 1996 , belong to the same group of fungicides.
Fenpropidin is a fungicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H332-H317-H318-H335-H373-H410 |
| Precautionary statements | P273-P280-P301+P312-P304+P340+P312-P305+P351+P338-P314 |
| target organs | Central nervous system, Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 21/22-36 |
| Safety Statements | 26-36/37 |
| RIDADR | 2902 |
| WGK Germany | 3 |
| RTECS | TM7292000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1B STOT RE 2 STOT SE 3 |










