A5393256
PymetrozinSolutioninMethanol , 100μg/mLinMethanol,uncertainty3% , 123312-89-0
CAS NO.:123312-89-0
Empirical Formula: C10H11N5O
Molecular Weight: 217.23
MDL number: MFCD01632346
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB63.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234.4° |
| Density | 1.36g/cm3 (20~25℃) |
| vapor pressure | 0Pa at 25.03℃ |
| Flash point: | >230 °C |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.90±0.40(Predicted) |
| form | Solid |
| color | White to Light Beige |
| BRN | 7814151 |
| Stability: | Hygroscopic |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C10H11N5O/c1-8-7-15(10(16)14-13-8)12-6-9-3-2-4-11-5-9/h2-6H,7H2,1H3,(H,14,16)/b12-6+ |
| InChIKey | QHMTXANCGGJZRX-WUXMJOGZSA-N |
| SMILES | CC1=NNC(=O)N(C1)\N=C\c2cccnc2 |
| LogP | -0.18 at 25℃ and pH7.1 |
| Surface tension | 69.4-72.3mN/m at 10g/L and 20℃ |
| Dissociation constant | 0.19-4.07 at 20℃ |
| CAS DataBase Reference | 123312-89-0(CAS DataBase Reference) |
| EPA Substance Registry System | Pymetrozine (123312-89-0) |
Description and Uses
Pymetrozine is a pyridine azomethine antifeedant. Pymetrozine is used as insecticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H361fd-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 40-52/53-R52/53-R40 |
| Safety Statements | 36/37-61-S61-S36/37 |
| WGK Germany | 2 |
| RTECS | XZ3018620 |
| HS Code | 29336990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Repr. 2 |
| Hazardous Substances Data | 123312-89-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 5820 mg/kg (Flückiger) |




