A5393912
Methyltriphenylphosphonium bromide , 98% , 1779-49-3
Synonym(s):
Methyltriphenylphosphonium bromide
CAS NO.:1779-49-3
Empirical Formula: C19H18BrP
Molecular Weight: 357.22
MDL number: MFCD00011804
EINECS: 217-218-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB31.20 | In Stock |
|
| 250g | RMB93.60 | In Stock |
|
| 500G | RMB100.80 | In Stock |
|
| 2.5kg | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-234 °C (lit.) |
| vapor pressure | 0.0000002 hPa |
| Flash point: | >240°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear |
| form | Powder |
| color | White |
| PH | 6.0-6.5 (400g/l, H2O, 20℃) |
| Water Solubility | 400 g/L (25 ºC) |
| Sensitive | Hygroscopic |
| BRN | 3599467 |
| InChI | 1S/C19H18P.BrH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1 |
| InChIKey | LSEFCHWGJNHZNT-UHFFFAOYSA-M |
| SMILES | [Br-].C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| LogP | -1.18 |
| CAS DataBase Reference | 1779-49-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyltriphenylphosphonium bromide(1779-49-3) |
| EPA Substance Registry System | Phosphonium, methyltriphenyl-, bromide (1779-49-3) |
Description and Uses
Methyltriphenylphosphonium bromide is used for methylenation through the Wittig reaction. It is utilized in the synthesis of an enyne and 9-isopropenyl -phenanthrene by using sodium amide as reagent. It is a lipophilic molecule and used to deliver molecules to specific cell components. Further, it acts as an antineoplastic agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H411 |
| Precautionary statements | P273-P301+P310+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-36-26 |
| RIDADR | UN 1390 4.3/PG 2 |
| WGK Germany | 3 |
| Autoignition Temperature | 410 °C |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 |
| Toxicity | LD50 orally in Rabbit: 118 mg/kg |








