A5393812
Methyltrioctylammonium chloride , 97% , 5137-55-3
Synonym(s):
Trioctylmethylammonium chloride
CAS NO.:5137-55-3
Empirical Formula: C25H54ClN
Molecular Weight: 404.16
MDL number: MFCD00011862
EINECS: 225-896-2
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB27.20 | In Stock |
|
| 25ML | RMB40.00 | In Stock |
|
| 100ML | RMB92.80 | In Stock |
|
| 500ML | RMB292.00 | In Stock |
|
| 2.5L | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -20°C |
| Boiling point: | 240°C |
| Density | 0.884 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform, Hexanes |
| form | Viscous Liquid |
| color | Colourless to pale orange |
| Odor | Ammonical |
| Water Solubility | Partially insoluble |
| Sensitive | Hygroscopic |
| BRN | 4039255 |
| Stability: | Stable. Incompatible wth strong oxidizing agents. Hygroscopic. |
| InChI | 1S/C25H54N.ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;/h5-25H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XKBGEWXEAPTVCK-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC |
| LogP | 4.5 at 25℃ |
| CAS DataBase Reference | 5137-55-3(CAS DataBase Reference) |
| EPA Substance Registry System | Methyltrioctylammonium chloride (5137-55-3) |
Description and Uses
Mixture of C8 and C10 chains with C8 predominating. Used as a metal extraction reagent and a phase-transfer catalyst.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H314-H360FD-H373-H410 |
| Precautionary statements | P202-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,C |
| Risk Statements | 22-38-41-50/53-36/37/38-20/21/22-34 |
| Safety Statements | 26-39-60-61-36-45-36/37/39 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UZ2997500 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Repr. 1B Skin Corr. 1A STOT RE 2 |









