PRODUCT Properties
| Melting point: | 50-54 °C |
| form | crystal |
| color | white |
| BRN | 4169201 |
| InChI | 1S/C32H68N.ClH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SNNIPOQLGBPXPS-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
Description and Uses
Tetraoctylammonium chloride is used as a:
- Cationic additive in the preparation of the polyaniline-based calcium selective electrode.
- Phase transfer catalyst in the Brust-Schiffrin synthesis of gold nanoparticles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
