A7638512
Tetrabutylammonium chloride , 97% , 1112-67-0
Synonym(s):
Tetra-n-butylammonium chloride
CAS NO.:1112-67-0
Empirical Formula: C16H36ClN
Molecular Weight: 277.92
MDL number: MFCD00011635
EINECS: 214-195-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 100G | RMB1880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-86°C |
| Density | 0.98 |
| bulk density | 700kg/m3 |
| refractive index | 1,421-1,423 |
| Flash point: | >110°C |
| storage temp. | Store below +30°C. |
| solubility | H2O: 20 mg/mL, clear, colorless |
| form | Crystalline Solid |
| color | White to brownish |
| PH Range | 5 - 8 at 100 g/l at 20°C |
| PH | 5-8 (100g/l, H2O, 20℃) |
| Water Solubility | SOLUBLE |
| λmax | λ: 220 nm Amax: 0.05 λ: 230 nm Amax: 0.04 λ: 250 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| Sensitive | Light Sensitive |
| BRN | 3571227 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. Combustible. |
| InChI | 1S/C16H36N.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NHGXDBSUJJNIRV-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 1112-67-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetra-N-butylammonium chloride(1112-67-0) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, chloride (1112-67-0) |
Description and Uses
Tetrabutylammonium Chloride is used in the preparation of polypyrrole coatings with self healing properties for iron corrosion.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |



