A0639156
Tetrabutylammoniumhydroxidesolution , 40wt.%inH2O , 2052-49-5
CAS NO.:2052-49-5
Empirical Formula: C16H37NO
Molecular Weight: 259.47
MDL number: MFCD00009425
EINECS: 218-147-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-30 °C(lit.) |
| Boiling point: | 100 °C |
| Density | 0.995 |
| vapor density | 1 (vs air) |
| vapor pressure | 2.3 kPa (@ 20°C) |
| refractive index | 1.4 |
| Flash point: | 7°C |
| storage temp. | Store below +30°C. |
| solubility | Miscible with organic solvents. |
| form | Solution |
| Specific Gravity | 0.8586 |
| color | APHA: ≤30 |
| Odor | Odorless |
| PH Range | 14 |
| PH | 14 (20°C in H2O) |
| explosive limit | 5.5-36.5% (v/v) Methanol) |
| Water Solubility | Soluble in water, methanol. |
| Sensitive | Air Sensitive/Hygroscopic |
| BRN | 3571228 |
| Exposure limits | ACGIH: TWA 200 ppm; STEL 250 ppm (Skin) OSHA: TWA 200 ppm(260 mg/m3) NIOSH: IDLH 6000 ppm; TWA 200 ppm(260 mg/m3); STEL 250 ppm(325 mg/m3) |
| Stability: | Volatile |
| InChI | 1S/C16H36N.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| LogP | 1.517 at 25℃ |
| CAS DataBase Reference | 2052-49-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, hydroxide (2052-49-5) |
Description and Uses
Tetrabutylammonium hydroxide(TBAOH) is a quaternary ammonium salt mainly used as a strong base and phase-transfer catalyst. TBAOH may be used as an ion-pairing reagent in mobile phase preparation for reverse phase ion-pair high performance liquid chromatography during chromium (III) and chromium (VI) determination.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317 |
| Precautionary statements | P261-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T,F,Xn |
| Risk Statements | 34-36/38-23/24/25-11-67-39/23/24/25-36-65-63-38-48/20-35-20/21/22-10-68/20/21/22 |
| Safety Statements | 7-16-26-36/37/39-45-36/37-62-27 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 1 |
| RTECS | BS5425000 |
| F | 9-34 |
| Hazard Note | Highly Flammable/Toxic/Corrosive/Air Sensitive/Hygroscopic |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29239000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





