A7718412
                    Tetrabutylammonium perchlorate , Electrochemical , 1923-70-2
                            Synonym(s):
TBAP
                            
                        
                CAS NO.:1923-70-2
Empirical Formula: C16H36ClNO4
Molecular Weight: 341.91
MDL number: MFCD00038722
EINECS: 217-655-5
| Pack Size | Price | Stock | Quantity | 
| 10G | RMB271.20 | In Stock | 
                                                 | 
                                        
| 50G | RMB1095.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 211-215 °C | 
                                    
| Density | 1.0387 (rough estimate) | 
                                    
| refractive index | 1.6800 (estimate) | 
                                    
| storage temp. | 2-8°C, sealed storage, away from moisture | 
                                    
| solubility | acetonitrile: 0.1 g/mL, clear, colorless | 
                                    
| form | Crystalline Powder | 
                                    
| color | White | 
                                    
| Water Solubility | Soluble in acetonitrile and ethanol. Very slightly soluble in water. | 
                                    
| Sensitive | Hygroscopic | 
                                    
| BRN | 3579274 | 
                                    
| Stability: | Stable. Strong oxidizer - contact with combustible material may cause fire. Incompatible with strong reducing agents, combustible materials. Do not heat. | 
                                    
| InChI | InChI=1S/C16H36N.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 | 
                                    
| InChIKey | KBLZDCFTQSIIOH-UHFFFAOYSA-M | 
                                    
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.Cl([O-])(=O)(=O)=O | 
                                    
| CAS DataBase Reference | 1923-70-2(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, perchlorate (1923-70-2) | 
                                    
Description and Uses
Tetrabutylammonium perchlorate is a tetraalkylammonium salt that can be used in phase-transfer catalysis.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07  | 
                                    
| Signal word | Danger | 
| Hazard statements | H272-H315-H319-H335 | 
| Precautionary statements | P210-P302+P352-P305+P351+P338 | 
| Hazard Codes | O,Xi | 
| Risk Statements | 5-8-36/37/38 | 
| Safety Statements | 17-26-36-36/37/39 | 
| RIDADR | UN 1479 5.1/PG 2 | 
| WGK Germany | 3 | 
| TSCA | Yes | 
| HazardClass | 5.1 | 
| PackingGroup | II | 
| HS Code | 29239000 | 





