A7692012
Tetrabutylammonium phosphate monobasic , HPLC , 5574-97-0
Synonym(s):
Tetrabutylammonium dihydrogen phosphate
CAS NO.:5574-97-0
Empirical Formula: C16H36N.H2O4P
Molecular Weight: 339.45
MDL number: MFCD00064526
EINECS: 226-947-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB652.80 | In Stock |
|
| 5G | RMB1143.20 | In Stock |
|
| 25G | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-154 °C(lit.) |
| Boiling point: | 81-82 °C |
| Density | 1.04 g/mL at 20 °C |
| refractive index | n |
| Flash point: | 43 °F |
| storage temp. | 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Soluble), Water (Soluble) |
| form | Solution |
| color | White to off-white |
| Specific Gravity | 1.010 |
| Odor | Amine like |
| PH Range | 4-5 |
| PH | 7.1 to 7.7(25 ℃) |
| Water Solubility | SOLUBLE |
| λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.04 λ: 300 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 5196532 |
| InChI | 1S/C16H36N.H3O4P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | ARRNBPCNZJXHRJ-UHFFFAOYSA-M |
| SMILES | OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 5574-97-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, phosphate (1:1) (5574-97-0) |
Description and Uses
Anion used to probe the structure, stability and intramolecular flexibility of a series of azacrown ethers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | 11-20/21/22-36-36/37/38-22-20/22 |
| Safety Statements | 26-36/37-45-37/39-24-16-7-24/25-36 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 13 - Non Combustible Solids |




