A7681412
Tetrabutylammonium hydrogen sulfate , Ion -specific chromatography , 32503-27-8
Synonym(s):
Tetrabutylammonium bisulfate;Tetrabutylammonium hydrogen sulfate;Tetrabutylammonium hydrogen sulfate solution;Tetra-n-butylammonium hydrogen sulfate
CAS NO.:32503-27-8
Empirical Formula: C16H37NO4S
Molecular Weight: 339.53
MDL number: MFCD00011637
EINECS: 251-068-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB52.00 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 100G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-174 °C |
| Boiling point: | 213.3-593.92℃[at 101 325 Pa] |
| bulk density | 650kg/m3 |
| Density | 1.01 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store below +30°C. |
| solubility | H2O: soluble10% (w/v), clear, colorless |
| form | Solution |
| Specific Gravity | 1.01 |
| color | White to beige |
| PH | 1-2 (100g/l, H2O, 20℃) |
| Odor | Amine like |
| PH Range | 1 - 2 |
| Water Solubility | Soluble |
| Sensitive | Hygroscopic |
| λmax | λ: 210 nm Amax: 0.06 λ: 220 nm Amax: 0.05 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3599663 |
| Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C16H36N.H2O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
| SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| LogP | 0.96 at 25℃ |
| CAS DataBase Reference | 32503-27-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutylammonium hydrogen sulfate(32503-27-8) |
| EPA Substance Registry System | Tetrabutylammonium sulfate (1:1) (32503-27-8) |
Description and Uses
A compound that displays antibacterial properties due to the presence of the quaternary amine and the counter ion. Tetrabutylammonium hydrogen sulfate is an ion pairing reagent that is used in liquid chromatography. It is frequently utilized in the analysis of pharmaceutical compounds and metabolites.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H412 |
| Precautionary statements | P260-P273-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8-10 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1 |





