A7718312
Tetrabutylammonium perchlorate , 99% , 1923-70-2
Synonym(s):
TBAP
CAS NO.:1923-70-2
Empirical Formula: C16H36ClNO4
Molecular Weight: 341.91
MDL number: MFCD00038722
EINECS: 217-655-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB52.80 | In Stock |
|
| 25G | RMB75.20 | In Stock |
|
| 100G | RMB271.20 | In Stock |
|
| 250g | RMB639.20 | In Stock |
|
| 500g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215 °C |
| Density | 1.0387 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in acetonitrile and ethanol. Very slightly soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3579274 |
| Stability: | Stable. Strong oxidizer - contact with combustible material may cause fire. Incompatible with strong reducing agents, combustible materials. Do not heat. |
| InChI | InChI=1S/C16H36N.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KBLZDCFTQSIIOH-UHFFFAOYSA-M |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.Cl([O-])(=O)(=O)=O |
| CAS DataBase Reference | 1923-70-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, perchlorate (1923-70-2) |
Description and Uses
Tetrabutylammonium perchlorate is a tetraalkylammonium salt that can be used in phase-transfer catalysis.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | O,Xi |
| Risk Statements | 5-8-36/37/38 |
| Safety Statements | 17-26-36-36/37/39 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 5.1 |
| PackingGroup | II |
| HS Code | 29239000 |





