A5396512
N-Methyl-D-glucamine , 99% , 6284-40-8
Synonym(s):
N-Methyl-D -glucamine;1-Deoxy-1-(methylamino)-D -glucitol;1-Deoxy-1-methylaminosorbitol;Meglumine
CAS NO.:6284-40-8
Empirical Formula: C7H17NO5
Molecular Weight: 195.21
MDL number: MFCD00004707
EINECS: 228-506-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB48.80 | In Stock |
|
| 250G | RMB101.60 | In Stock |
|
| 500G | RMB199.20 | In Stock |
|
| 1KG | RMB392.80 | In Stock |
|
| 5kg | RMB1438.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-131.5 °C (lit.) |
| Boiling point: | 331.88°C (rough estimate) |
| alpha | -16.5 º (c=10, H2O, on dry sub) |
| Density | 1.2669 (rough estimate) |
| bulk density | 300kg/m3 |
| refractive index | -16.5 ° (C=2, H2O) |
| RTECS | LZ4295770 |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | pKa 9.39(H2O,t =30.0,I=0.05N2)(Approximate) |
| form | Crystalline Powder |
| color | White to almost white |
| PH | 11 (10g/l, H2O, 20℃) |
| biological source | synthetic (organic) |
| optical activity | [α]20/D 16.5±0.5°, c = 2% in H2O |
| Water Solubility | 100 g/100 mL (25 ºC) |
| Sensitive | Air Sensitive & Hygroscopic |
| Merck | 14,6078 |
| BRN | 385906 |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | 1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| InChIKey | MBBZMMPHUWSWHV-VZFHVOOUSA-N |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| LogP | -3.370 (est) |
| NIST Chemistry Reference | N-methylglucamine(6284-40-8) |
| EPA Substance Registry System | Meglumine (6284-40-8) |
Description and Uses
antiinflammatory
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10-23 |
| Autoignition Temperature | ~662 °F |
| TSCA | TSCA listed |
| HS Code | 29221980 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: > 5000 mg/kg |







