A5401156
ClothianidinSolutioninAcetonitrile , 1000μg/mLinAcetonitrile,uncertainty2% , 210880-92-5
Synonym(s):
(E)-1-(2-Chloro-5-thiazolylmethyl)-3-methyl-2-nitroguanidine
CAS NO.:210880-92-5
Empirical Formula: C6H8ClN5O2S
Molecular Weight: 249.67
MDL number: MFCD06200753
EINECS: 205-516-1
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178.8 °C |
| Boiling point: | 412.5±55.0 °C(Predicted) |
| Density | 1.61 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | 0-6°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.50 mg/ml |
| pka | 2.76±0.50(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| Water Solubility | 327 mg/L at 20 ºC |
| Major Application | agriculture environmental |
| InChI | 1S/C6H8ClN5O2S/c1-8-6(11-12(13)14)10-3-4-2-9-5(7)15-4/h2H,3H2,1H3,(H2,8,10,11) |
| InChIKey | PGOOBECODWQEAB-UHFFFAOYSA-N |
| SMILES | CN\C(NCc1cnc(Cl)s1)=N/[N+]([O-])=O |
| LogP | 0.7 at 25℃ |
| CAS DataBase Reference | 210880-92-5 |
| EPA Substance Registry System | Clothianidin (210880-92-5) |
Description and Uses
Insecticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 46-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| RTECS | ME9565000 |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 210880-92-5(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 in rats (mg/l): >6.1 inhalation; LC50 in bobwhite quail, mallard duck (ppm): >5200, >5200 (dietary); LC50 (96 hr) in rainbow trout, bluegill (mg/l): >100, >120 (Ohkawara) |





