A5402512
Methyl 2,5-Dihydroxybenzoate , 98% , 2150-46-1
Synonym(s):
Methyl gentisate
CAS NO.：2150-46-1
Empirical Formula: C8H8O4
Molecular Weight: 168.15
MDL number: MFCD00016464
EINECS: 218-427-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB162.40 | In Stock |
|
| 100G | RMB500.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C (lit.) |
| Boiling point: | 136 °C / 1mmHg |
| Density | 1.354±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.87±0.18(Predicted) |
| color | Off-White to Pale Beige |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | InChI=1S/C8H8O4/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4,9-10H,1H3 |
| InChIKey | XGDPKUKRQHHZTH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(O)=CC=C1O |
| LogP | 1.830 (est) |
| CAS DataBase Reference | 2150-46-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2,5-dihydroxy-, methyl ester(2150-46-1) |
Description and Uses
Methyl 2,5-dihydroxybenzoate (methyl gentisate) may be used as a starting material in the synthesis of euonyminol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29182900 |
