A5413012
L-Methionine Methyl Ester Hydrochloride , 98% , 2491-18-1
CAS NO.:2491-18-1
Empirical Formula: C6H14ClNO2S
Molecular Weight: 199.7
MDL number: MFCD00012491
EINECS: 219-651-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 10g | RMB70.40 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB364.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-153 °C(lit.) |
| alpha | 26 º (c=5, H2O 24 ºC) |
| refractive index | 26 ° (C=1, H2O) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | White to beige |
| optical activity | [α]22/D +25.9°, c = 1 in H2O |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3913214 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C6H13NO2S.ClH/c1-9-6(8)5(7)3-4-10-2;/h5H,3-4,7H2,1-2H3;1H/t5-;/s3 |
| InChIKey | MEVUPUNLVKELNV-USHJBNIQNA-N |
| SMILES | [C@H](N)(CCSC)C(=O)OC.Cl |&1:0,r| |
| CAS DataBase Reference | 2491-18-1(CAS DataBase Reference) |
Description and Uses
L-Methionine methyl ester hydrochloride is used as a starting material for the synthesis of a protected glycine derivative, a versatile asymmetric building block.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |







