A7471512
<SC>L</SC>-Methionine ethyl ester hydrochloride , 99% , 2899-36-7
CAS NO.：2899-36-7
Empirical Formula: C7H16ClNO2S
Molecular Weight: 213.73
MDL number: MFCD00012508
EINECS: 220-787-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.80 | In Stock |
|
| 10G | RMB63.20 | In Stock |
|
| 25g | RMB155.20 | In Stock |
|
| 100g | RMB611.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| alpha | 21 º (c=2 in ethanol) |
| Boiling point: | 258° |
| Flash point: | 110° |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| color | White to off-white |
| optical activity | [α]25/D +21°, c = 2 in ethanol |
| BRN | 3913812 |
| Major Application | peptide synthesis |
| InChI | 1S/C7H15NO2S.ClH/c1-3-10-7(9)6(8)4-5-11-2;/h6H,3-5,8H2,1-2H3;1H/t6-;/m0./s1 |
| InChIKey | KPWCQEUBJAIORR-RGMNGODLSA-N |
| SMILES | Cl[H].CCOC(=O)[C@@H](N)CCSC |
| CAS DataBase Reference | 2899-36-7(CAS DataBase Reference) |
Description and Uses
L-Methionine ethyl ester, Hydrochloride is a methionine ester with antioxidant properties.
Safety
| Symbol(GHS) |   GHS07,GHS02 |
| Signal word | Danger |
| Hazard statements | H332-H319-H335-H336-H225 |
| Precautionary statements | P501-P261-P240-P210-P233-P243-P241-P242-P271-P264-P280-P370+P378-P337+P313-P305+P351+P338-P303+P361+P353-P304+P340+P312-P403+P233-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 13 - Non Combustible Solids |
