A5416012
4-Methyl-2-nitroaniline , 98% , 89-62-3
Synonym(s):
2-Nitro-p-toluidine;4-Amino-3-nitrotoluene
CAS NO.:89-62-3
Empirical Formula: C7H8N2O2
Molecular Weight: 152.15
MDL number: MFCD00057926
EINECS: 201-924-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-116 °C (lit.) |
| Boiling point: | 169°C (21 mmHg) |
| Density | 1,164 g/cm3 |
| vapor pressure | 0.06Pa at 25℃ |
| refractive index | 1.6276 (estimate) |
| Flash point: | 157°C |
| storage temp. | −20°C |
| solubility | 0.2g/l |
| Colour Index | 37110 |
| pka | 0.46±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Orange to orange-brown |
| Water Solubility | Soluble in water (0.2 g/L at 20°C). |
| BRN | 879506 |
| InChI | 1S/C7H8N2O2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | DLURHXYXQYMPLT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)c(c1)[N+]([O-])=O |
| LogP | 0.568 at 23℃ |
| CAS DataBase Reference | 89-62-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitro-4-aminotoluene(89-62-3) |
| EPA Substance Registry System | 4-Methyl-2-nitroaniline (89-62-3) |
Description and Uses
4-Methyl-2-nitroaniline is used as a red azo dye.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373-H411 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N,Xi |
| Risk Statements | 23/24/25-33-51/53 |
| Safety Statements | 28-36/37-45-61 |
| RIDADR | UN 2660 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XU8227250 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 STOT RE 2 |
| Toxicity | LD50 intraperitoneal in mouse: > 500mg/kg |









