A5417412
Methane Base , 98% , 101-61-1
Synonym(s):
N,N,N′,N′-Tetramethyl-4,4′-diaminodiphenylmethane;N,N,N′,N′-Tetramethyl-4,4′-methylenedianiline;Arnolds base;Michlers base
CAS NO.:101-61-1
Empirical Formula: C17H22N2
Molecular Weight: 254.37
MDL number: MFCD00008317
EINECS: 202-959-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| 250G | RMB549.60 | In Stock |
|
| 500G | RMB588.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-89 °C(lit.) |
| Boiling point: | 390 °C |
| Density | 1.0344 (rough estimate) |
| refractive index | 1.5794 (estimate) |
| Flash point: | 178 °C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 5.57±0.12(Predicted) |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | Off-white or light gray or beige-brown |
| Water Solubility | Insoluble |
| Merck | 14,6176 |
| BRN | 479956 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acids, acid chlorides, acid anhydrides, active metals, oxides, chlorates, halogenated compounds, iron chloride, nitro acompounds, peroxides, strong ammonia solution, sulfides, vinyl polymers. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C17H22N2/c1-18(2)16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)19(3)4/h5-12H,13H2,1-4H3 |
| InChIKey | JNRLEMMIVRBKJE-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(Cc2ccc(cc2)N(C)C)cc1 |
| CAS DataBase Reference | 101-61-1(CAS DataBase Reference) |
| IARC | 2B (Vol. 27, Sup 7, 99) 2010 |
| NIST Chemistry Reference | Benzenamine, 4,4'-methylenebis[N,N-dimethyl-(101-61-1) |
| EPA Substance Registry System | 4,4'-Methylenebis[N,N-dimethylaniline] (101-61-1) |
Description and Uses
4,4-Methylenebis(N,N-dimethyl)benzenamineis a yellow crystalline compound. Molecular weight =254.41; Boiling point = 390℃; Freezing/Melting point =90- 91℃. Hazard Identification (based on NFPA-704 MRating System): Health 2, Flammability 1, Reactivity 0.Insoluble in water.
4,4'-Methylenebis(N,N-dimethylaniline)is used as a chemical intermediate in the manufacture of dyes and for its hydrochloric salt and is also used as an analytical reagent in the determination of lead.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H350-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,N,Xi |
| Risk Statements | 45-50/53 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | BY5250000 |
| Hazard Note | Harmful/Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29215990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B |
| Hazardous Substances Data | 101-61-1(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




