A5422012
MPEG-maleimide , M.W.5000 , 99126-64-4
Synonym(s):
MeO-PEG-Mal;mono-Methyl polyethylene glycol 2-maleimidoethyl ether;PEG-maleimide
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB399.20 | In Stock |
|
| 1G | RMB1095.20 | In Stock |
|
| 5G | RMB4383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-52 °C |
| Flash point: | >110 °C |
| storage temp. | -20°C |
| form | solid |
| color | White to off-white |
| α-end | methoxy |
| Ω-end | maleimide |
| InChI | InChI=1S/C9H13NO4/c1-13-6-7-14-5-4-10-8(11)2-3-9(10)12/h2-3H,4-7H2,1H3 |
| InChIKey | SXUGMTRUWIBRPR-UHFFFAOYSA-N |
| SMILES | C(N1C(C=CC1=O)=O)CO{-}CC{+n}OC |
Description and Uses
for immobilization, water insoluble version of 7-00246
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 39072090 |
| Storage Class | 11 - Combustible Solids |






