A5422612
2-Methyl-5-nitrophenol , 98% , 5428-54-6
CAS NO.:5428-54-6
Empirical Formula: C7H7NO3
Molecular Weight: 153.14
MDL number: MFCD00043909
EINECS: 226-580-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100g | RMB159.20 | In Stock |
|
| 500g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-115 °C(lit.) |
| Boiling point: | 180 °C / 15mmHg |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 8.68±0.19(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C7H7NO3/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,9H,1H3 |
| InChIKey | UMFDLIXUUJMPSI-UHFFFAOYSA-N |
| SMILES | C1(O)=CC([N+]([O-])=O)=CC=C1C |
| CAS DataBase Reference | 5428-54-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Methyl-5-nitrophenol(5428-54-6) |
| EPA Substance Registry System | Phenol, 2-methyl-5-nitro- (5428-54-6) |
Description and Uses
2-Methyl-5-nitrophenol is used as a reactant in the preparation of pyranocarbazole alkaloids.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H311-H315-H319-H332-H335 |
| Precautionary statements | P280h-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 2446 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089000 |





