A5425912
Methyl 3-hydroxybenzoate , 99% , 19438-10-9
CAS NO.:19438-10-9
Empirical Formula: C8H8O3
Molecular Weight: 152.15
MDL number: MFCD00002295
EINECS: 243-071-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB137.60 | In Stock |
|
| 250g | RMB317.60 | In Stock |
|
| 500G | RMB459.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-72 °C (lit.) |
| Boiling point: | 280-281 °C/709 mmHg (lit.) |
| Density | 1.1528 |
| refractive index | 1.4447 (estimate) |
| Flash point: | 280-281°C/708mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform, dimetyl Sulfoxide,ethanol and methanol. |
| pka | 9.15±0.10(Predicted) |
| form | Crystals |
| color | Beige |
| BRN | 2208129 |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5,9H,1H3 |
| InChIKey | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(O)=C1 |
| LogP | 1.890 |
| CAS DataBase Reference | 19438-10-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-HO-C6H4-COOCH3(19438-10-9) |
Description and Uses
Methyl 3-hydroxybenzoate has been used in synthesis of:
- 3-hydroxybenzene-1,2-dicarbaldehyde
- O-methyl O-[3-methyl-4-(methylthio)phenyl]O-(3-methylcarboxyphenyl) phosphorothioate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163100 |




