A5428712
Myristoyl chloride , 98% , 112-64-1
Synonym(s):
Tetradecanoyl chloride
CAS NO.:112-64-1
Empirical Formula: C14H27ClO
Molecular Weight: 246.82
MDL number: MFCD00000741
EINECS: 203-994-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -1 °C (lit.) |
| Boiling point: | 250 °C/100 mmHg (lit.) |
| Density | 0.908 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | −20°C |
| form | Liquid |
| color | Clear colorless to light yellow-brown |
| Water Solubility | MAY DECOMPOSE |
| BRN | 636924 |
| InChI | InChI=1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3 |
| InChIKey | LPWCRLGKYWVLHQ-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCCCCCCCCCC |
| CAS DataBase Reference | 112-64-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Myristoyl chloride(112-64-1) |
| EPA Substance Registry System | Tetradecanoyl chloride (112-64-1) |
Description and Uses
Myristoyl chloride was used in the synthesis of 6-azafulleroid-6-deoxy-2,3-di-O-myristoylcellulose. It was used in N-acylation of chitosan to introduce hydrophobicity for use as matrix for drug delivery. It was used in the synthesis of semi-crystalline dendritic poly(ether-amide) derivatives.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37-22 |
| Safety Statements | 26-36/37/39-45-28B |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





