A5432012
6-Methyluracil , ≥98% , 626-48-2
Synonym(s):
2,4-Dihydroxy-6-methylpyrimidine
CAS NO.：626-48-2
Empirical Formula: C5H6N2O2
Molecular Weight: 126.11
MDL number: MFCD00006028
EINECS: 210-949-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB23.20 | In Stock |
|
| 100G | RMB39.20 | In Stock |
|
| 250g | RMB95.20 | In Stock |
|
| 500G | RMB151.20 | In Stock |
|
| 2.5KG | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 318 °C (dec.)(lit.) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| pka | pK1:9.52 (25°C) |
| form | Fine Crystalline Powder |
| color | White to almost white |
| Water Solubility | 7 g/L (22 ºC) |
| Merck | 14,6133 |
| BRN | 115647 |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | SHVCSCWHWMSGTE-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC(=O)N1 |
| CAS DataBase Reference | 626-48-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Methyluracil(626-48-2) |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, 6-methyl- (626-48-2) |
Description and Uses
6-Methyluracil (cas# 626-48-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361 |
| Precautionary statements | P281 |
| Hazard Codes | Xn |
| Risk Statements | 62-63 |
| Safety Statements | 36/37/39-45-36/37 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | YR0700000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29335995 |
| Hazardous Substances Data | 626-48-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 64500mg/kg |
