A5438812
2-Bromo-4'-methylacetophenone , 97% , 619-41-0
CAS NO.:619-41-0
Empirical Formula: C9H9BrO
Molecular Weight: 213.07
MDL number: MFCD00000203
EINECS: 210-595-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB266.40 | In Stock |
|
| 100G | RMB889.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-49 °C(lit.) |
| Boiling point: | 238-239 °C(lit.) |
| Density | 0.993 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 229 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate |
| form | Crystalline Powder or Needles |
| color | White to light yellow |
| BRN | 607041 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | InChI=1S/C9H9BrO/c1-7-2-4-8(5-3-7)9(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | KRVGXFREOJHJAX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(C)C=C1)CBr |
| CAS DataBase Reference | 619-41-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 2-bromo-1-(4-methylphenyl)-(619-41-0) |
Description and Uses
2-Bromo-4′-methylacetophenone was used in the general fluorous thiol quenching method. It was also used in the preparation of hydroxyquinolinone and N-derivatized carboxamides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






