A5439912
2,2′-Methylenebis[(4S)-4-tert-butyl-2-oxazoline] , ≥96.0% , 132098-54-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB456.00 | In Stock |
|
| 1G | RMB1142.40 | In Stock |
|
| 5G | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-53 °C(lit.) |
| Boiling point: | 328.8±25.0 °C(Predicted) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.39±0.70(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 118°, c = 0.5 in chloroform |
| BRN | 4190673 |
| InChI | InChI=1S/C15H26N2O2/c1-14(2,3)10-8-18-12(16-10)7-13-17-11(9-19-13)15(4,5)6/h10-11H,7-9H2,1-6H3/t10-,11-/m1/s1 |
| InChIKey | WCCCBUXURHZPQL-GHMZBOCLSA-N |
| SMILES | C(C1=N[C@@H](C(C)(C)C)CO1)C1=N[C@@H](C(C)(C)C)CO1 |
Description and Uses
C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |

![2,2′-Methylenebis[(4S)-4-tert-butyl-2-oxazoline]](https://img.chemicalbook.com/CAS/GIF/132098-54-5.gif)

![2,2′-Isopropylidenebis[(4S)-4-tert-butyl-2-oxazoline]](https://img.chemicalbook.com/CAS/GIF/131833-93-7.gif)
![2,2-Bis[(4R)-4-isopropyl-2-oxazolin-2-yl]propane](https://img.chemicalbook.com/CAS/20200119/GIF/150529-94-5.gif)

