A5440512
2'-Methylacetoacetanilide , 99% , 93-68-5
Synonym(s):
2′-Methylacetoacetanilide
CAS NO.:93-68-5
Empirical Formula: C11H13NO2
Molecular Weight: 191.23
MDL number: MFCD00008782
EINECS: 202-267-0
| Pack Size | Price | Stock | Quantity |
| 100G | RMB28.80 | In Stock |
|
| 250g | RMB47.20 | In Stock |
|
| 500G | RMB69.60 | In Stock |
|
| 25g | RMB104.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-106 °C(lit.) |
| Boiling point: | 326.97°C (rough estimate) |
| Density | 1.06 |
| vapor pressure | 0.01 hPa ( 20 °C) |
| refractive index | 1.5220 (estimate) |
| Flash point: | 143°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.22±0.46(Predicted) |
| form | powder to crystal |
| color | Crystals |
| BRN | 2099098 |
| InChI | 1S/C11H13NO2/c1-8-5-3-4-6-10(8)12-11(14)7-9(2)13/h3-6H,7H2,1-2H3,(H,12,14) |
| InChIKey | TVZIWRMELPWPPR-UHFFFAOYSA-N |
| SMILES | N(c1c(cccc1)C)C(=O)CC(=O)C |
| LogP | 0.9 at 23℃ |
| CAS DataBase Reference | 93-68-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanamide, n-(2-methylphenyl)-3-oxo-(93-68-5) |
| EPA Substance Registry System | Butanamide, N-(2-methylphenyl)-3-oxo- (93-68-5) |
Description and Uses
2'-Methylacetoacetanilide is used as intermediate for the manufacture of organic pigments as well as for the manufacture of agrochemicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-20/21/22 |
| Safety Statements | 36-36/37-24/25 |
| WGK Germany | 1 |
| RTECS | AK6550000 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orl-rat: 1600 mg/kg KODAK* -,N-229,76 |







