A5441312
Mono-2-ethylhexyl Phthalate , Analysis standard , 4376-20-9
Synonym(s):
mono-2-Ethylhexyl phthalate
CAS NO.:4376-20-9
Empirical Formula: C16H22O4
Molecular Weight: 278.34
MDL number: MFCD00041500
EINECS: 224-477-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB143.20 | In Stock |
|
| 500MG | RMB528.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-27℃ |
| Boiling point: | 341.16°C (rough estimate) |
| Density | 0,107 g/cm3 |
| refractive index | n/D1.5051 |
| Flash point: | >93 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid (Colorless) |
| pka | 3.37±0.36(Predicted) |
| color | Colourless to Off-White Oil |
| BRN | 3206630 |
| InChI | 1S/C16H22O4/c1-3-5-8-12(4-2)11-20-16(19)14-10-7-6-9-13(14)15(17)18/h6-7,9-10,12H,3-5,8,11H2,1-2H3,(H,17,18) |
| InChIKey | DJDSLBVSSOQSLW-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=CC=CC=C1C(OCC(CC)CCCC)=O |
| EPA Substance Registry System | Mono(2-ethylhexyl) phthalate (4376-20-9) |
Description and Uses
Phthalate metabolite, responsible for inducing apoptosis in germ and Sertoli cells by disrupting junction complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | TI2500000 |
| HS Code | 2917340090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |



