A5442212
N-Methyl-1-naphthylmethylamine Hydrochloride , 97% , 65473-13-4
Synonym(s):
N-Methyl-1-naphthalenemethylamine hydrochloride
CAS NO.:65473-13-4
Empirical Formula: C12H14ClN
Molecular Weight: 207.7
MDL number: MFCD00012555
EINECS: 613-801-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.00 | In Stock |
|
| 5G | RMB183.20 | In Stock |
|
| 25G | RMB502.40 | In Stock |
|
| 100g | RMB1368.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-193 °C(lit.) |
| Boiling point: | 287.9℃[at 101 325 Pa] |
| Density | 1,05g/cm |
| vapor pressure | 0.323Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | soluble |
| Merck | 14,9171 |
| InChI | InChI=1S/C12H13N.ClH/c1-13-9-11-7-4-6-10-5-2-3-8-12(10)11;/h2-8,13H,9H2,1H3;1H |
| InChIKey | BVJVHPKFDIYQOU-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC1=CC=CC=2CNC.Cl |
| CAS DataBase Reference | 65473-13-4(CAS DataBase Reference) |
Description and Uses
N-Methyl-1-naphthalenemethanamine hydrochloride is an intermediate used in the synthesis of various pharmaceuticals such as Terbinafine hydrochloride (T107500) and Butenafine hydrochloride (B690195).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P305+P351+P338-P261-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |




![N-[(2E)-6,6-DiMethyl-2-hepten-4-yn-1-yl]-N,4-diMethyl-1-naphthaleneMethanaMine Hydrochloride](https://img.chemicalbook.com/CAS/GIF/877265-33-3.gif)

