A5443512
Metoxuron , Analysis standard , 19937-59-8
CAS NO.：19937-59-8
Empirical Formula: C10H13ClN2O2
Molecular Weight: 228.68
MDL number: MFCD00055444
EINECS: 243-433-2
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-127 °C |
| Boiling point: | 391.6±42.0 °C(Predicted) |
| Density | 1.3100 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 13.83±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 678mg/L(23 ºC) |
| Major Application | agriculture environmental |
| InChI | 1S/C10H13ClN2O2/c1-13(2)10(14)12-7-4-5-9(15-3)8(11)6-7/h4-6H,1-3H3,(H,12,14) |
| InChIKey | DSRNRYQBBJQVCW-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)N(C)C)cc1Cl |
| EPA Substance Registry System | Metoxuron (19937-59-8) |
Description and Uses
Metoxuron is used as a herbicide.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N,Xn,F |
| Risk Statements | 50/53-36-20/21/22-11 |
| Safety Statements | 60-61-36-26-16-36/37 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | WGK 2 |
| RTECS | YS5775000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | mouse,LD50,oral,2542mg/kg (2542mg/kg),ENDOCRINE: OTHER CHANGESBLOOD: OTHER CHANGES,Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 47(2), Pg. 13, 1982. |
