A5453912
2-Methoxy-4-methyl-6-(methylamino)-1,3,5-triazine , 97% , 5248-39-5
CAS NO.:5248-39-5
Empirical Formula: C6H10N4O
Molecular Weight: 154.17
MDL number: MFCD00585858
EINECS: 401-360-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB65.44 | In Stock |
|
| 100g | RMB164.80 | In Stock |
|
| 500G | RMB534.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-166 °C(lit.) |
| Boiling point: | 304.9±25.0 °C(Predicted) |
| Density | 1.196±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 3.80±0.10(Predicted) |
| color | Pale Beige |
| InChI | InChI=1S/C6H10N4O/c1-4-8-5(7-2)10-6(9-4)11-3/h1-3H3,(H,7,8,9,10) |
| InChIKey | MNDSUSQBIDHEJU-UHFFFAOYSA-N |
| SMILES | N1=C(C)N=C(OC)N=C1NC |
| CAS DataBase Reference | 5248-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3,5-Triazin-2-amine, 4-methoxy-N,6-dimethyl- (5248-39-5) |
Description and Uses
4-Methoxy-n,6-dimethyl-1,3,5-triazin-2-amine is a metabolite of tribenuron-methyl used in herbicidal formulations or used as herbicides.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H335-H373-H302-H315-H319 |
| Precautionary statements | P261-P280-P264-P270-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-48-48/22-37-21/22 |
| Safety Statements | 26-36-22-2-36/37 |
| WGK Germany | 3 |
| RTECS | XY2905180 |
| TSCA | TSCA listed |
| HS Code | 2933698090 |








