LN9632353
98% , 82097-50-5
CAS NO.:82097-50-5
Empirical Formula: C14H16ClN5O5S
Molecular Weight: 401.83
MDL number: MFCD00145436
EINECS: 232-520-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1128.80 | In Stock |
|
| 1g | RMB2620.80 | In Stock |
|
| 5g | RMB8985.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178°C |
| Boiling point: | 150-260 °C |
| Density | 1.5218 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5630 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 4.34±0.10(Predicted) |
| BRN | 7151883 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H16ClN5O5S/c1-9-16-12(19-14(17-9)24-2)18-13(21)20-26(22,23)11-6-4-3-5-10(11)25-8-7-15/h3-6H,7-8H2,1-2H3,(H2,16,17,18,19,20,21) |
| InChIKey | XOPFESVZMSQIKC-UHFFFAOYSA-N |
| SMILES | COc1nc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2OCCCl)n1 |
| LogP | 1.6-2.6 at 25℃ and pH5-9 |
| Dissociation constant | 4.64 at 20℃ |
| CAS DataBase Reference | 82097-50-5(CAS DataBase Reference) |
| EPA Substance Registry System | Triasulfuron (82097-50-5) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H332-H410 |
| Precautionary statements | P261-P271-P273-P304+P340+P312-P391-P501 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DB1554000 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 82097-50-5(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 (4 hr) in rats: >5185 mg/m3 by inhalation (Amrein, Gerber) |







