A7820612
Tolbutamide , ≥99% , 64-77-7
Synonym(s):
N-[(Butylamino)carbonyl]-4-methylbenzenesulfonamide;1-Butyl-3-(4-methylphenylsulfonyl)urea;Tolbutamide
CAS NO.:64-77-7
Empirical Formula: C12H18N2O3S
Molecular Weight: 270.35
MDL number: MFCD00027169
EINECS: 200-594-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 10g | RMB119.20 | In Stock |
|
| 25G | RMB144.80 | In Stock |
|
| 100G | RMB441.60 | In Stock |
|
| 250g | RMB1359.20 | In Stock |
|
| 500G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130°C |
| Density | 1.2450 |
| refractive index | 1.6360 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform. |
| form | Solid |
| pka | pKa 5.32(H2O
t = 37) (Uncertain) |
| color | White to Off-White |
| biological source | synthetic (organic) |
| Water Solubility | 0.14g/L(25 ºC) |
| Merck | 14,9507 |
| BRN | 1984428 |
| Specific Activity | 50-60 mCi/mmol |
| Concentration | 0.1 mCi/ml |
| Solvent | Ethanol |
| Stability: | Stable. Combustible. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| CAS DataBase Reference | 64-77-7(CAS DataBase Reference) |
| EPA Substance Registry System | Tolbutamide (64-77-7) |
Description and Uses
An antidiabetic, used as a hypoglycemic agent in veterinary medicine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P280g-P301+P312a-P321-P333+P313-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,Xn |
| Risk Statements | 20/21/22-40-43-36-11 |
| Safety Statements | 26-36/37/39-36/37-16-24/25 |
| WGK Germany | 2 |
| RTECS | YS4550000 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 64-77-7(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 2490mg/kg |






