A5455312
3-Methoxybutyl Ester , 99% , 4435-53-4
CAS NO.:4435-53-4
Empirical Formula: C7H14O3
Molecular Weight: 146.18
MDL number: MFCD00043928
EINECS: 224-644-9
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 172 °C |
| Density | 0,96 g/cm3 |
| refractive index | 1.4070-1.4090 |
| Flash point: | 62°C |
| form | clear liquid |
| color | Colorless |
| Water Solubility | 60.68g/L(20 ºC) |
| InChI | InChI=1S/C7H14O3/c1-6(9-3)4-5-10-7(2)8/h6H,4-5H2,1-3H3 |
| InChIKey | QMYGFTJCQFEDST-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)CC(OC)C |
| LogP | 1.007 at 20℃ |
| CAS DataBase Reference | 4435-53-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Butanol, 3-methoxy-, acetate(4435-53-4) |
| EPA Substance Registry System | 1-Butanol, 3-methoxy-, 1-acetate (4435-53-4) |
Description and Uses
Butoxyl is a colorless liquid with a sharp odor.Molecular weight=146.19; Specific gravity (H2O:1)=0.96; Boiling point=169-173℃; Melting/Freezingpoint =,- 80℃; Flash point=62℃ (cc); 77℃.Hazard Identification (based on NFPA-704 M RatingSystem): Health 1, Flammability 2, Reactivity 1. Slightlysoluble in water; solubility=30 g/L.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1993 |
| RTECS | EL4725000 |
| TSCA | TSCA listed |
| HS Code | 2918999090 |
| Toxicity | rat,LD50,oral,4210mg/kg (4210mg/kg),AMA Archives of Industrial Hygiene and Occupational Medicine. Vol. 10, Pg. 61, 1954. |






