A5456212
Mesotrione , Analysis standard , 104206-82-8
Synonym(s):
2-(4-Mesyl-2-nitrobenzoyl)-1,3-cyclohexanedione
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB544.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165° |
| Boiling point: | 643.3±55.0 °C(Predicted) |
| Density | 1.474±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| pka | pKa (20°): 3.12 |
| form | Solid |
| color | White to off-white |
| BRN | 8999656 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C14H13NO7S/c1-23(21,22)8-5-6-9(10(7-8)15(19)20)14(18)13-11(16)3-2-4-12(13)17/h5-7,13H,2-4H2,1H3 |
| InChIKey | KPUREKXXPHOJQT-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCC(=O)C1C(=O)C1=CC=C(S(C)(=O)=O)C=C1[N+]([O-])=O |
| LogP | -0.700 (est) |
| CAS DataBase Reference | 104206-82-8(CAS DataBase Reference) |
| EPA Substance Registry System | Mesotrione (104206-82-8) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H361d-H373-H410 |
| Precautionary statements | P202-P260-P273-P280-P308+P313-P391 |
| target organs | Eyes,Nervous system |
| PPE | Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 STOT RE 2 |
| Hazardous Substances Data | 104206-82-8(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 in rats (mg/l): >5 by inhalation; LC50 (96 hr) in bluegill sunfish, rainbow trout (mg/l): >120, >120 |






