A7344312
Sulcotrione , Analysis standard product, 97.5% , 99105-77-8
Synonym(s):
2-[2-Chloro-4-(methylsulfonyl)benzoyl]-1,3-cyclohexanedione
CAS NO.:99105-77-8
Empirical Formula: C14H13ClO5S
Molecular Weight: 328.77
MDL number: MFCD01632349
EINECS: 278-636-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139° |
| Boiling point: | 574.5±50.0 °C(Predicted) |
| Density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.22±0.50(Predicted) |
| color | White to off-white |
| Merck | 13,8979 |
| BRN | 8155739 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H13ClO5S/c1-21(19,20)8-5-6-9(10(15)7-8)14(18)13-11(16)3-2-4-12(13)17/h5-7,13H,2-4H2,1H3 |
| InChIKey | PQTBTIFWAXVEPB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(c(Cl)c1)C(=O)C2C(=O)CCCC2=O |
| EPA Substance Registry System | 1,3-Cyclohexanedione, 2-[2-chloro-4-(methylsulfonyl)benzoyl]- (99105-77-8) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H361d-H373-H410 |
| Precautionary statements | P202-P260-P273-P280-P302+P352-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 43-50/53-48/22-63 |
| Safety Statements | 36/37-61-60-22 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 Skin Sens. 1A STOT RE 2 |








