BD3351851
2-Acetylcyclohexane-1,3-dione , 97% , 4056-73-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB96.00 | In Stock |
|
| 1g | RMB230.40 | In Stock |
|
| 5g | RMB784.00 | In Stock |
|
| 10g | RMB1344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20 °C (lit.) |
| Boiling point: | 85 °C/0.1 mmHg (lit.) |
| Density | 1.1690 (rough estimate) |
| refractive index | 1.4787 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 3.50±0.25(Predicted) |
| form | solid |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C8H10O3/c1-5(9)8-6(10)3-2-4-7(8)11/h8H,2-4H2,1H3 |
| InChIKey | CHNXDYRMRBQOEF-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCC(=O)C1C(C)=O |
Description and Uses
The product has been used in the chelation of aqueous iron(III) th at is present in alcoholic drinks, such as wine and beer. It affects beer fermentation, stability and quality. It has also been used to evaluate mesotrione assay specificity as its structure is similar to mesotrione (a triketone herbicide).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2914290090 |






