A5457412
Methyl 4-imidazolecarboxylate , 98% , 17325-26-7
CAS NO.：17325-26-7
Empirical Formula: C5H6N2O2
Molecular Weight: 126.11
MDL number: MFCD00216584
EINECS: 626-673-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB236.80 | In Stock |
|
| 25g | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-156 °C (lit.) |
| Boiling point: | 318.2±15.0 °C(Predicted) |
| Density | 1.46 g/cm3 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 10.89±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C5H6N2O2/c1-9-5(8)4-2-6-3-7-4/h2-3H,1H3,(H,6,7) |
| InChIKey | DVLGIQNHKLWSRU-UHFFFAOYSA-N |
| SMILES | C1NC(C(OC)=O)=CN=1 |
| CAS DataBase Reference | 17325-26-7(CAS DataBase Reference) |
Description and Uses
Methyl 4-imidazolecarboxylate was used as a starting material in the synthesis of 1-(3-prop-1-enyl)-imidazole-4-carboxyaldehyde and osmium(2,2′-bipyridyl)2(methyl 4-imidazolcarboxylate)dichloride.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
