A5457612
(-)-Methyl (S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate , 95% , 60456-21-5
Synonym(s):
α,β-Isopropylidene-L -glyceric acid methyl ester;Methyl α,β-isopropylidene-L -glycerate;Methyl 2,3-O-isopropylidene-L -glycerate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB180.00 | In Stock |
|
| 5G | RMB544.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84-86 °C/15 mmHg (lit.) |
| Density | 1.106 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 78°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | liquid |
| color | Pale yellow |
| optical activity | [α]20/D 8.5°, c = 1.5 in acetone |
| BRN | 4292352 |
| InChI | InChI=1S/C7H12O4/c1-7(2)10-4-5(11-7)6(8)9-3/h5H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | DOWWCCDWPKGNGX-YFKPBYRVSA-N |
| SMILES | O1C[C@@H](C(OC)=O)OC1(C)C |
Description and Uses
(?)-Methyl (S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate can be used:
- As a chiral building block to make the key tetrahydrofuran subunit of (?)-gymnodimine, a marine algal toxin.
- To prepare an enedione by reacting with dimethyl methylphosphonate, BuLi, and phenylglyoxal, which in turn is used to synthesize cyclopentenone derivatives.
- As a starting material for the preparation of (S)-4,5-dihydroxy-2,3-pentanedione (DPD), a precursor for autoinducer (AI)-2 in bacteria.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 2932990090 |
