A5461112
5-Methoxy-2-tetralone , 97% , 32940-15-1
Synonym(s):
5-methoxy-3,4-dihydronaphthalen-2(1H)-one
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB161.60 | In Stock |
|
| 25g | RMB415.20 | In Stock |
|
| 100g | RMB1260.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-36 °C (lit.) |
| Boiling point: | 165°C/10mmHg(lit.) |
| Density | 1.124±0.06 g/cm3(Predicted) |
| vapor pressure | 0.059Pa at 25℃ |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate, Methanol |
| form | Solid |
| color | Yellowish Orange |
| BRN | 1451623 |
| InChI | InChI=1S/C11H12O2/c1-13-11-4-2-3-8-7-9(12)5-6-10(8)11/h2-4H,5-7H2,1H3 |
| InChIKey | MDAIAXRTLTVEOU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(OC)=CC=C2)CCC1=O |
| LogP | 1.8 at 25℃ |
| CAS DataBase Reference | 32940-15-1(CAS DataBase Reference) |
Description and Uses
Intermediate in the production of Rotigotine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 Skin Sens. 1 |






