A5461312
7-Methoxy-2-tetralone , 98% , 4133-34-0
CAS NO.：4133-34-0
Empirical Formula: C11H12O2
Molecular Weight: 176.21
MDL number: MFCD00001730
EINECS: 223-954-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB395.20 | In Stock |
|
| 100g | RMB1516.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 23-24 °C |
| Boiling point: | 124-126 °C/1.5 mmHg (lit.) |
| Density | 1.13 g/mL at 25 °C (lit.) |
| vapor pressure | 0.19Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Liquid After Melting |
| color | Clear yellow to orange |
| Specific Gravity | 1.130 |
| Water Solubility | 1.151g/L at 25℃ |
| BRN | 1953198 |
| InChI | InChI=1S/C11H12O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | XEAPZXNZOJGVCZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(OC)=C2)CCC1=O |
| LogP | 1.99 at 25℃ |
| CAS DataBase Reference | 4133-34-0(CAS DataBase Reference) |
Description and Uses
7-Methoxy-2-tetralone was used in the synthesis of 2-bromo-3,4-dihydro-7-methoxy-1-naphthaldehyde and 2-substituted octahydrobenzo[f]quinolines.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P501-P260-P270-P264-P280-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29145090 |
