A5461512
5-Methoxy-1-indanone , 98% , 5111-70-6
CAS NO.:5111-70-6
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00003789
EINECS: 225-838-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB491.20 | In Stock |
|
| 100g | RMB1915.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-109 °C (lit.) |
| Boiling point: | 150 °C / 2mmHg |
| Density | 1.0281 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Light green-brownish |
| Odor Threshold | 0.00048ppm |
| BRN | 1282137 |
| InChI | InChI=1S/C10H10O2/c1-12-8-3-4-9-7(6-8)2-5-10(9)11/h3-4,6H,2,5H2,1H3 |
| InChIKey | QOPRWBRNMPANKN-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(OC)C=C2)CC1 |
| CAS DataBase Reference | 5111-70-6(CAS DataBase Reference) |
Description and Uses
The cytotoxic potential of 5-methoxy-1-indanone was assessed.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Warning |
| Hazard statements | H260-H314 |
| Precautionary statements | P264b-P271-P280-P301+P330+P331-P302+P335+P334-P304+P340-P305+P351+P338-P310-P363-P370+P378r-P402+P404-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36/37-36-26 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |







