A3112012
5,6-Dimethoxy-1-indanone , 98% , 2107-69-9
CAS NO.：2107-69-9
Empirical Formula: C11H12O3
Molecular Weight: 192.21
MDL number: MFCD00003790
EINECS: 218-287-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB210.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118120°C |
| Boiling point: | 139 °C / 2mmHg |
| Density | 1.1503 (rough estimate) |
| refractive index | 1.4600 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| color | Off-White to Pale Yellow |
| BRN | 1241095 |
| InChI | InChI=1S/C11H12O3/c1-13-10-5-7-3-4-9(12)8(7)6-11(10)14-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(OC)C(OC)=C2)CC1 |
| CAS DataBase Reference | 2107-69-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Indanone, 5,6-dimethoxy-,(2107-69-9) |
| EPA Substance Registry System | 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy- (2107-69-9) |
Description and Uses
5,6-Dimethoxy-1-indanone was used in the synthesis of 2,3-dimethoxy-11H-indeno[1,2-b]quinoline-6,10-dicarboxylic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P362+P364-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2914390090 |
