A5461712
6-Methoxy-1-indanone , 98% , 13623-25-1
CAS NO.:13623-25-1
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00021232
EINECS: 603-948-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB100.00 | In Stock |
|
| 25G | RMB454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-109 °C (lit.) |
| Boiling point: | 228.88°C (rough estimate) |
| Density | 1.0281 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Fine Crystalline Powder |
| color | White to yellow |
| BRN | 1238602 |
| InChI | InChI=1S/C10H10O2/c1-12-8-4-2-7-3-5-10(11)9(7)6-8/h2,4,6H,3,5H2,1H3 |
| InChIKey | UJGDLLGKMWVCPT-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(OC)=C2)CC1 |
| CAS DataBase Reference | 13623-25-1(CAS DataBase Reference) |
Description and Uses
6-Methoxy-1-indanone was used in the synthesis of 5-methoxyninhydrin (2,2-dihydroxy-5-methoxy-1,3-indanedione).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335 |
| Precautionary statements | P261-P271-P304+P340-P312-P403+P233-P501c |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36/37-36-26 |
| WGK Germany | 3 |
| HS Code | 29145090 |







